Kenpaullone
Catalog No: FT-0670607
CAS No: 142273-20-9
- Chemical Name: Kenpaullone
- Molecular Formula: C16H11BrN2O
- Molecular Weight: 327.17
- InChI Key: QQUXFYAWXPMDOE-UHFFFAOYSA-N
- InChI: InChI=1S/C16H11BrN2O/c17-9-5-6-14-11(7-9)12-8-15(20)18-13-4-2-1-3-10(13)16(12)19-14/h1-7,19H,8H2,(H,18,20)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 327.175 |
| Density: | 1.6±0.1 g/cm3 |
| CAS: | 142273-20-9 |
| Bolling_Point: | 613.0±45.0 °C at 760 mmHg |
| Product_Name: | Kenpaullone |
| Melting_Point: | >300ºC (dec.) |
| Flash_Point: | 324.5±28.7 °C |
| MF: | C16H11BrN2O |
| LogP: | 4.02 |
|---|---|
| Flash_Point: | 324.5±28.7 °C |
| Refractive_Index: | 1.730 |
| FW: | 327.175 |
| Bolling_Point: | 613.0±45.0 °C at 760 mmHg |
| Density: | 1.6±0.1 g/cm3 |
| Melting_Point: | >300ºC (dec.) |
| PSA: | 44.89000 |
| Exact_Mass: | 326.005463 |
| Vapor_Pressure: | 0.0±1.8 mmHg at 25°C |
| MF: | C16H11BrN2O |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi: Irritant; |
| Risk_Statements(EU): | R36/37/38 |
| Safety_Statements: | 26-36 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| Warning_Statement: | P261-P305 + P351 + P338 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)